Compound Q&A

What are the physical and chemical properties of 6-(Trifluoromethyl)nicotinic acid (CAS: 231291-22-8)?

Answer

6-(Trifluoromethyl)nicotinic acid
6-(Trifluoromethyl)nicotinic acid (CAS: 231291-22-8) is a white crystalline solid with a molecular weight of approximately 248.12 g/mol. It has a pKa of about 2.3, indicating it is a weak acid. The compound is slightly soluble in water and soluble in organic solvents such as ethanol and acetonitrile. It is chemically stable under normal conditions but should be stored in a dry, sealed container to prevent moisture absorption.

About

English Name 6-(Trifluoromethyl)nicotinic acid
Molecular Formula C7H4F3NO2
Molecular Weight 191.11 g/mol
SMILES C1=CC(=NC=C1C(=O)O)C(F)(F)F
InChIKey JNYLMODTPLSLIF-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

How is 6-(Trifluoromethyl)nicotinic acid (CAS: 231291-22-8) typically synthesized?

6-(Trifluoromethyl)nicotinic acid can be synthesized by the trifluoromethylation of nicotinic acid. ...

Compound Q&A

What industries use 6-(Trifluoromethyl)nicotinic acid (CAS: 231291-22-8)?

6-(Trifluoromethyl)nicotinic acid (CAS: 231291-22-8) is primarily used in the pharmaceutical industr...

Compound Q&A

What precautions should be taken when handling 6-(Trifluoromethyl)nicotinic acid (CAS: 231291-22-8)?

When handling 6-(Trifluoromethyl)nicotinic acid (CAS: 231291-22-8), it is essential to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...