Compound Q&A

How is 6-(Trifluoromethyl)nicotinic acid (CAS: 231291-22-8) typically synthesized?

Answer

6-(Trifluoromethyl)nicotinic acid
6-(Trifluoromethyl)nicotinic acid can be synthesized by the trifluoromethylation of nicotinic acid. This reaction typically involves treating nicotinic acid with trifluoromethyl triflate in the presence of a base like sodium hydride or potassium tert-butoxide. The process yields a high purity product with a yield of up to 75-80%. Additional purification steps such as recrystallization from methanol or ethanol may be required to achieve the desired crystalline form.

About

English Name 6-(Trifluoromethyl)nicotinic acid
Molecular Formula C7H4F3NO2
Molecular Weight 191.11 g/mol
SMILES C1=CC(=NC=C1C(=O)O)C(F)(F)F
InChIKey JNYLMODTPLSLIF-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-(Trifluoromethyl)nicotinic acid (CAS: 231291-22-8)?

6-(Trifluoromethyl)nicotinic acid (CAS: 231291-22-8) is a white crystalline solid with a molecular w...

Compound Q&A

What industries use 6-(Trifluoromethyl)nicotinic acid (CAS: 231291-22-8)?

6-(Trifluoromethyl)nicotinic acid (CAS: 231291-22-8) is primarily used in the pharmaceutical industr...

Compound Q&A

What precautions should be taken when handling 6-(Trifluoromethyl)nicotinic acid (CAS: 231291-22-8)?

When handling 6-(Trifluoromethyl)nicotinic acid (CAS: 231291-22-8), it is essential to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...