Compound Q&A

What industries use Ethyl 3-carbamimidamido-4-methylbenzoate nitrate (CAS: 641569-96-2)?

Answer

Ethyl 3-carbamimidamido-4-methylbenzoate nitrate (1:1)
Ethyl 3-carbamimidamido-4-methylbenzoate nitrate (CAS: 641569-96-2) is primarily used in the pharmaceutical industry for the synthesis of certain drugs. It also finds applications in the preparation of polymer additives, where its chemical properties make it useful in modifying the characteristics of various polymers. Additionally, it can be employed in sensor technology and semiconductor manufacturing due to its unique reactivity and stability.

About

English Name Ethyl 3-carbamimidamido-4-methylbenzoate nitrate (1:1)
Molecular Formula C11H16N4O5
Molecular Weight 284.27 g/mol
SMILES CCOC(=O)C1=CC(=C(C=C1)C)N=C(N)N.[N+](=O)(O)[O-]
InChIKey YQMZYKJPGMVZJL-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 3-carbamimidamido-4-methylbenzoate nitrate (CAS: 641569-96-2)?

Ethyl 3-carbamimidamido-4-methylbenzoate nitrate (CAS: 641569-96-2) is a crystalline compound with a...

Compound Q&A

How is Ethyl 3-carbamimidamido-4-methylbenzoate nitrate (CAS: 641569-96-2) typically synthesized?

Ethyl 3-carbamimidamido-4-methylbenzoate nitrate (CAS: 641569-96-2) is typically synthesized via a m...

Compound Q&A

What precautions should be taken when handling Ethyl 3-carbamimidamido-4-methylbenzoate nitrate (CAS: 641569-96-2)?

When handling Ethyl 3-carbamimidamido-4-methylbenzoate nitrate (CAS: 641569-96-2), appropriate perso...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...