Compound Q&A

How is Ethyl 3-carbamimidamido-4-methylbenzoate nitrate (CAS: 641569-96-2) typically synthesized?

Answer

Ethyl 3-carbamimidamido-4-methylbenzoate nitrate (1:1)
Ethyl 3-carbamimidamido-4-methylbenzoate nitrate (CAS: 641569-96-2) is typically synthesized via a multi-step process involving the reaction of 4-methylbenzoic acid with ethyl isocyanate, followed by nitration. The synthesis generally requires the use of a catalyst such as concentrated sulfuric acid. The overall yield is around 70-80%, with good selectivity towards the desired nitrate ester product.

About

English Name Ethyl 3-carbamimidamido-4-methylbenzoate nitrate (1:1)
Molecular Formula C11H16N4O5
Molecular Weight 284.27 g/mol
SMILES CCOC(=O)C1=CC(=C(C=C1)C)N=C(N)N.[N+](=O)(O)[O-]
InChIKey YQMZYKJPGMVZJL-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 3-carbamimidamido-4-methylbenzoate nitrate (CAS: 641569-96-2)?

Ethyl 3-carbamimidamido-4-methylbenzoate nitrate (CAS: 641569-96-2) is a crystalline compound with a...

Compound Q&A

What industries use Ethyl 3-carbamimidamido-4-methylbenzoate nitrate (CAS: 641569-96-2)?

Ethyl 3-carbamimidamido-4-methylbenzoate nitrate (CAS: 641569-96-2) is primarily used in the pharmac...

Compound Q&A

What precautions should be taken when handling Ethyl 3-carbamimidamido-4-methylbenzoate nitrate (CAS: 641569-96-2)?

When handling Ethyl 3-carbamimidamido-4-methylbenzoate nitrate (CAS: 641569-96-2), appropriate perso...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...