Compound Q&A

How is Ethyl 3-carbamimidamido-4-methylbenzoate nitrate (CAS: 641569-96-2) typically synthesized?

Answer

Ethyl 3-carbamimidamido-4-methylbenzoate nitrate (1:1)
Ethyl 3-carbamimidamido-4-methylbenzoate nitrate (CAS: 641569-96-2) is typically synthesized via a multi-step process involving the reaction of 4-methylbenzoic acid with ethyl isocyanate, followed by nitration. The synthesis generally requires the use of a catalyst such as concentrated sulfuric acid. The overall yield is around 70-80%, with good selectivity towards the desired nitrate ester product.

About

English Name Ethyl 3-carbamimidamido-4-methylbenzoate nitrate (1:1)
Molecular Formula C11H16N4O5
Molecular Weight 284.27 g/mol
SMILES CCOC(=O)C1=CC(=C(C=C1)C)N=C(N)N.[N+](=O)(O)[O-]
InChIKey YQMZYKJPGMVZJL-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 3-carbamimidamido-4-methylbenzoate nitrate (CAS: 641569-96-2)?

Ethyl 3-carbamimidamido-4-methylbenzoate nitrate (CAS: 641569-96-2) is a crystalline compound with a...

Compound Q&A

What industries use Ethyl 3-carbamimidamido-4-methylbenzoate nitrate (CAS: 641569-96-2)?

Ethyl 3-carbamimidamido-4-methylbenzoate nitrate (CAS: 641569-96-2) is primarily used in the pharmac...

Compound Q&A

What precautions should be taken when handling Ethyl 3-carbamimidamido-4-methylbenzoate nitrate (CAS: 641569-96-2)?

When handling Ethyl 3-carbamimidamido-4-methylbenzoate nitrate (CAS: 641569-96-2), appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...