Compound Q&A

What are the physical and chemical properties of Ethyl 3-carbamimidamido-4-methylbenzoate nitrate (CAS: 641569-96-2)?

Answer

Ethyl 3-carbamimidamido-4-methylbenzoate nitrate (1:1)
Ethyl 3-carbamimidamido-4-methylbenzoate nitrate (CAS: 641569-96-2) is a crystalline compound with a molecular weight of approximately 377.18 g/mol. It is slightly soluble in water but soluble in organic solvents like ethanol and acetone. The compound is relatively stable under normal conditions but can react with strong bases or acids. It has a melting point of around 130-135°C and a density of about 1.35 g/cm³.

About

English Name Ethyl 3-carbamimidamido-4-methylbenzoate nitrate (1:1)
Molecular Formula C11H16N4O5
Molecular Weight 284.27 g/mol
SMILES CCOC(=O)C1=CC(=C(C=C1)C)N=C(N)N.[N+](=O)(O)[O-]
InChIKey YQMZYKJPGMVZJL-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

How is Ethyl 3-carbamimidamido-4-methylbenzoate nitrate (CAS: 641569-96-2) typically synthesized?

Ethyl 3-carbamimidamido-4-methylbenzoate nitrate (CAS: 641569-96-2) is typically synthesized via a m...

Compound Q&A

What industries use Ethyl 3-carbamimidamido-4-methylbenzoate nitrate (CAS: 641569-96-2)?

Ethyl 3-carbamimidamido-4-methylbenzoate nitrate (CAS: 641569-96-2) is primarily used in the pharmac...

Compound Q&A

What precautions should be taken when handling Ethyl 3-carbamimidamido-4-methylbenzoate nitrate (CAS: 641569-96-2)?

When handling Ethyl 3-carbamimidamido-4-methylbenzoate nitrate (CAS: 641569-96-2), appropriate perso...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...