Compound Q&A

What industries use Tipifarnib (CAS: 192185-72-1)?

Answer

Tipifarnib
Tipifarnib is primarily used in the pharmaceutical industry for the development of cancer treatments. It has shown potential in targeting RAS oncogenes, which are frequently mutated in various cancers. Though less common, it has applications in research for studying protein farnesylation and its role in cellular processes.

About

English Name Tipifarnib
Molecular Formula C27H22Cl2N4O
Molecular Weight 489.41 g/mol
SMILES CN1C=NC=C1C(C2=CC=C(C=C2)Cl)(C3=CC4=C(C=C3)N(C(=O)C=C4C5=CC(=CC=C5)Cl)C)N
InChIKey PLHJCIYEEKOWNM-HHHXNRCGSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tipifarnib (CAS: 192185-72-1)?

Tipifarnib is a crystalline compound with a molecular weight of approximately 414.55 g/mol. Its solu...

Compound Q&A

How is Tipifarnib (CAS: 192185-72-1) typically synthesized?

Tipifarnib is synthesized via a multi-step process involving condensation, alkylation, and functiona...

Compound Q&A

What precautions should be taken when handling Tipifarnib (CAS: 192185-72-1)?

When handling Tipifarnib, appropriate personal protective equipment (PPE) is essential, including gl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...