Compound Q&A

What are the physical and chemical properties of Tipifarnib (CAS: 192185-72-1)?

Answer

Tipifarnib
Tipifarnib is a crystalline compound with a molecular weight of approximately 414.55 g/mol. Its solubility in water is low, and it is slightly soluble in ethanol. Tipifarnib exhibits good stability in acidic and basic conditions but is reactive towards strong oxidizing agents. It is typically stored at room temperature in a desiccator.

About

English Name Tipifarnib
Molecular Formula C27H22Cl2N4O
Molecular Weight 489.41 g/mol
SMILES CN1C=NC=C1C(C2=CC=C(C=C2)Cl)(C3=CC4=C(C=C3)N(C(=O)C=C4C5=CC(=CC=C5)Cl)C)N
InChIKey PLHJCIYEEKOWNM-HHHXNRCGSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

How is Tipifarnib (CAS: 192185-72-1) typically synthesized?

Tipifarnib is synthesized via a multi-step process involving condensation, alkylation, and functiona...

Compound Q&A

What industries use Tipifarnib (CAS: 192185-72-1)?

Tipifarnib is primarily used in the pharmaceutical industry for the development of cancer treatments...

Compound Q&A

What precautions should be taken when handling Tipifarnib (CAS: 192185-72-1)?

When handling Tipifarnib, appropriate personal protective equipment (PPE) is essential, including gl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...