Compound Q&A

How is Tipifarnib (CAS: 192185-72-1) typically synthesized?

Answer

Tipifarnib
Tipifarnib is synthesized via a multi-step process involving condensation, alkylation, and functional group transformations. Key steps include the synthesis of a piperidine ring and subsequent alkylation at the C20 position of farnesyl pyrophosphate. The reaction typically uses organic solvents and catalysts like palladium, with high selectivity and yield around 80-90%.

About

English Name Tipifarnib
Molecular Formula C27H22Cl2N4O
Molecular Weight 489.41 g/mol
SMILES CN1C=NC=C1C(C2=CC=C(C=C2)Cl)(C3=CC4=C(C=C3)N(C(=O)C=C4C5=CC(=CC=C5)Cl)C)N
InChIKey PLHJCIYEEKOWNM-HHHXNRCGSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tipifarnib (CAS: 192185-72-1)?

Tipifarnib is a crystalline compound with a molecular weight of approximately 414.55 g/mol. Its solu...

Compound Q&A

What industries use Tipifarnib (CAS: 192185-72-1)?

Tipifarnib is primarily used in the pharmaceutical industry for the development of cancer treatments...

Compound Q&A

What precautions should be taken when handling Tipifarnib (CAS: 192185-72-1)?

When handling Tipifarnib, appropriate personal protective equipment (PPE) is essential, including gl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...