Compound Q&A

What industries use 2,3-Dihydro-1-benzofuran-5-ylacetic acid (CAS: 69999-16-2)?

Answer

2,3-Dihydro-1-benzofuran-5-ylacetic acid
2,3-Dihydro-1-benzofuran-5-ylacetic acid is used in various industries due to its versatile chemical properties. It is primarily used in the pharmaceutical sector for the synthesis of certain drug intermediates. Additionally, it finds applications in the development of sensors for detecting specific analytes, as well as in the production of certain polymers and materials. Its use in semiconductors and electronic devices is also being explored for its potential in organic electronics.

About

CAS No 69999-16-2
English Name 2,3-Dihydro-1-benzofuran-5-ylacetic acid
Molecular Formula C10H10O3
Molecular Weight 178.18699999999995 g/mol
SMILES C1COC2=C1C=C(C=C2)CC(=O)O
InChIKey LALSYIKKTXUSLG-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,3-Dihydro-1-benzofuran-5-ylacetic acid (CAS: 69999-16-2)?

2,3-Dihydro-1-benzofuran-5-ylacetic acid is a white or off-white crystalline solid with a molecular ...

Compound Q&A

How is 2,3-Dihydro-1-benzofuran-5-ylacetic acid (CAS: 69999-16-2) typically synthesized?

2,3-Dihydro-1-benzofuran-5-ylacetic acid can be synthesized through a multi-step process involving t...

Compound Q&A

What precautions should be taken when handling 2,3-Dihydro-1-benzofuran-5-ylacetic acid (CAS: 69999-16-2)?

When handling 2,3-Dihydro-1-benzofuran-5-ylacetic acid, it is important to use appropriate personal ...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...