Compound Q&A

What are the physical and chemical properties of 2,3-Dihydro-1-benzofuran-5-ylacetic acid (CAS: 69999-16-2)?

Answer

2,3-Dihydro-1-benzofuran-5-ylacetic acid
2,3-Dihydro-1-benzofuran-5-ylacetic acid is a white or off-white crystalline solid with a molecular weight of approximately 248.24 g/mol. It has a slight pungent odor. This compound is soluble in ethanol, chloroform, and methanol but poorly soluble in water. It is an electrophilic compound and exhibits moderate reactivity under basic conditions, making it suitable for various synthetic transformations. The compound can form anhydrous crystalline forms and has a melting point around 215-217°C.

About

CAS No 69999-16-2
English Name 2,3-Dihydro-1-benzofuran-5-ylacetic acid
Molecular Formula C10H10O3
Molecular Weight 178.19 g/mol
SMILES C1COC2=C1C=C(C=C2)CC(=O)O
InChIKey LALSYIKKTXUSLG-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

How is 2,3-Dihydro-1-benzofuran-5-ylacetic acid (CAS: 69999-16-2) typically synthesized?

2,3-Dihydro-1-benzofuran-5-ylacetic acid can be synthesized through a multi-step process involving t...

Compound Q&A

What industries use 2,3-Dihydro-1-benzofuran-5-ylacetic acid (CAS: 69999-16-2)?

2,3-Dihydro-1-benzofuran-5-ylacetic acid is used in various industries due to its versatile chemical...

Compound Q&A

What precautions should be taken when handling 2,3-Dihydro-1-benzofuran-5-ylacetic acid (CAS: 69999-16-2)?

When handling 2,3-Dihydro-1-benzofuran-5-ylacetic acid, it is important to use appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...