Compound Q&A

How is 2,3-Dihydro-1-benzofuran-5-ylacetic acid (CAS: 69999-16-2) typically synthesized?

Answer

2,3-Dihydro-1-benzofuran-5-ylacetic acid
2,3-Dihydro-1-benzofuran-5-ylacetic acid can be synthesized through a multi-step process involving the condensation of an appropriate aromatic compound with acetic anhydride. A typical synthesis involves the reaction of 5-benzofuranone with acetic anhydride in the presence of an acid catalyst, such as sulfuric acid. The product is then isolated by recrystallization from an appropriate solvent. The yield is generally around 75-85%, with high selectivity and purity.

About

CAS No 69999-16-2
English Name 2,3-Dihydro-1-benzofuran-5-ylacetic acid
Molecular Formula C10H10O3
Molecular Weight 178.18699999999995 g/mol
SMILES C1COC2=C1C=C(C=C2)CC(=O)O
InChIKey LALSYIKKTXUSLG-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,3-Dihydro-1-benzofuran-5-ylacetic acid (CAS: 69999-16-2)?

2,3-Dihydro-1-benzofuran-5-ylacetic acid is a white or off-white crystalline solid with a molecular ...

Compound Q&A

What industries use 2,3-Dihydro-1-benzofuran-5-ylacetic acid (CAS: 69999-16-2)?

2,3-Dihydro-1-benzofuran-5-ylacetic acid is used in various industries due to its versatile chemical...

Compound Q&A

What precautions should be taken when handling 2,3-Dihydro-1-benzofuran-5-ylacetic acid (CAS: 69999-16-2)?

When handling 2,3-Dihydro-1-benzofuran-5-ylacetic acid, it is important to use appropriate personal ...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...