Compound Q&A

What industries use 3-Chloro-2-fluorobenzoic acid (CAS: 161957-55-7)?

Answer

3-Chloro-2-fluorobenzoic acid
3-Chloro-2-fluorobenzoic acid is used in the pharmaceutical industry for the synthesis of certain drugs. It is also utilized in the production of dyes, sensors, and in materials science for the development of polymers and semiconductors.

About

English Name 3-Chloro-2-fluorobenzoic acid
Molecular Formula C7H4ClFO2
Molecular Weight 174.56 g/mol
SMILES C1=CC(=C(C(=C1)Cl)F)C(=O)O
InChIKey FCSSYEWURMTUSM-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Chloro-2-fluorobenzoic acid (CAS: 161957-55-7)?

3-Chloro-2-fluorobenzoic acid is a crystalline solid with a molecular weight of approximately 191.58...

Compound Q&A

How is 3-Chloro-2-fluorobenzoic acid (CAS: 161957-55-7) typically synthesized?

3-Chloro-2-fluorobenzoic acid can be synthesized via the reaction of 2-fluorobenzoic acid with thion...

Compound Q&A

What precautions should be taken when handling 3-Chloro-2-fluorobenzoic acid (CAS: 161957-55-7)?

When handling 3-Chloro-2-fluorobenzoic acid, it is essential to wear appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...