Compound Q&A

How is 3-Chloro-2-fluorobenzoic acid (CAS: 161957-55-7) typically synthesized?

Answer

3-Chloro-2-fluorobenzoic acid
3-Chloro-2-fluorobenzoic acid can be synthesized via the reaction of 2-fluorobenzoic acid with thionyl chloride. The reaction is carried out under mild conditions, with a yield of approximately 90%. This method involves the substitution of a hydrogen atom on the carboxylic acid group with a chlorine atom.

About

English Name 3-Chloro-2-fluorobenzoic acid
Molecular Formula C7H4ClFO2
Molecular Weight 174.56 g/mol
SMILES C1=CC(=C(C(=C1)Cl)F)C(=O)O
InChIKey FCSSYEWURMTUSM-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Chloro-2-fluorobenzoic acid (CAS: 161957-55-7)?

3-Chloro-2-fluorobenzoic acid is a crystalline solid with a molecular weight of approximately 191.58...

Compound Q&A

What industries use 3-Chloro-2-fluorobenzoic acid (CAS: 161957-55-7)?

3-Chloro-2-fluorobenzoic acid is used in the pharmaceutical industry for the synthesis of certain dr...

Compound Q&A

What precautions should be taken when handling 3-Chloro-2-fluorobenzoic acid (CAS: 161957-55-7)?

When handling 3-Chloro-2-fluorobenzoic acid, it is essential to wear appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...