Compound Q&A

What industries use ginsenoside F4 (CAS: 181225-33-2)?

Answer

ginsenoside F4
Ginsenoside F4 (CAS: 181225-33-2) is primarily used in the pharmaceutical industry for its potential health benefits, particularly in the development of anti-inflammatory and anti-tumor drugs. It is also used in the food and cosmetic industries as a functional ingredient. Additionally, its chemical structure makes it relevant to the research in materials science for its potential use in sensors and semiconductors.

About

English Name ginsenoside F4
Molecular Formula C42H70O12
Molecular Weight 767 g/mol
SMILES OCC1OC(OC2CC3(C)C(C4(C2C(C)(C)C(O)CC4)C)CC(C2C3(C)CCC2C(=CCC=C(C)C)C)O)C(C(C1O)O)OC1OC(C)C(C(C1O)O)O
InChIKey QOMBXPYXWGTFNR-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of ginsenoside F4 (CAS: 181225-33-2)?

Ginsenoside F4 (CAS: 181225-33-2) is a crystalline compound with a molecular weight of approximately...

Compound Q&A

How is ginsenoside F4 (CAS: 181225-33-2) typically synthesized?

Ginsenoside F4 (CAS: 181225-33-2) is typically synthesized through semi-synthetic methods starting f...

Compound Q&A

What precautions should be taken when handling ginsenoside F4 (CAS: 181225-33-2)?

When handling ginsenoside F4 (CAS: 181225-33-2), appropriate personal protective equipment (PPE) suc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...