Compound Q&A

What are the physical and chemical properties of ginsenoside F4 (CAS: 181225-33-2)?

Answer

ginsenoside F4
Ginsenoside F4 (CAS: 181225-33-2) is a crystalline compound with a molecular weight of approximately 818.33 Da. It is slightly soluble in water and ethanol, and practically insoluble in hexane. It is relatively stable under normal conditions but can react with acidic or basic conditions. Ginsenoside F4 exhibits selective activity in biological systems and is often used in research for its pharmacological properties.

About

English Name ginsenoside F4
Molecular Formula C42H70O12
Molecular Weight 767 g/mol
SMILES OCC1OC(OC2CC3(C)C(C4(C2C(C)(C)C(O)CC4)C)CC(C2C3(C)CCC2C(=CCC=C(C)C)C)O)C(C(C1O)O)OC1OC(C)C(C(C1O)O)O
InChIKey QOMBXPYXWGTFNR-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

How is ginsenoside F4 (CAS: 181225-33-2) typically synthesized?

Ginsenoside F4 (CAS: 181225-33-2) is typically synthesized through semi-synthetic methods starting f...

Compound Q&A

What industries use ginsenoside F4 (CAS: 181225-33-2)?

Ginsenoside F4 (CAS: 181225-33-2) is primarily used in the pharmaceutical industry for its potential...

Compound Q&A

What precautions should be taken when handling ginsenoside F4 (CAS: 181225-33-2)?

When handling ginsenoside F4 (CAS: 181225-33-2), appropriate personal protective equipment (PPE) suc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...