Compound Q&A

What industries use 2-Bromo-5-nitrobenzoic acid (CAS: 943-14-6)?

Answer

2-Bromo-5-nitrobenzoic acid
2-Bromo-5-nitrobenzoic acid is used in the pharmaceutical industry for the synthesis of certain drugs, particularly those requiring bromine and nitro functionalities. It is also utilized in the polymer industry for the modification of polymers and in the semiconductor industry for the preparation of photoresists and other materials.

About

CAS No 943-14-6
English Name 2-Bromo-5-nitrobenzoic acid
Molecular Formula C7H4BrNO4
Molecular Weight 246.02 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])C(=O)O)Br
InChIKey UVFWYVCDRKRAJH-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Bromo-5-nitrobenzoic acid (CAS: 943-14-6)?

2-Bromo-5-nitrobenzoic acid is a crystalline solid with a molecular weight of approximately 229.03 g...

Compound Q&A

How is 2-Bromo-5-nitrobenzoic acid (CAS: 943-14-6) typically synthesized?

2-Bromo-5-nitrobenzoic acid is commonly synthesized by bromination of 5-nitrobenzoic acid using N-br...

Compound Q&A

What precautions should be taken when handling 2-Bromo-5-nitrobenzoic acid (CAS: 943-14-6)?

When handling 2-Bromo-5-nitrobenzoic acid, it is essential to use appropriate personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...