Compound Q&A

How is 2-Bromo-5-nitrobenzoic acid (CAS: 943-14-6) typically synthesized?

Answer

2-Bromo-5-nitrobenzoic acid
2-Bromo-5-nitrobenzoic acid is commonly synthesized by bromination of 5-nitrobenzoic acid using N-bromosuccinimide (NBS) in the presence of a radical initiator like benzoyl peroxide. The bromination step is typically carried out in an organic solvent like dichloromethane. Yields are generally high, and the product can be isolated by recrystallization.

About

CAS No 943-14-6
English Name 2-Bromo-5-nitrobenzoic acid
Molecular Formula C7H4BrNO4
Molecular Weight 246.02 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])C(=O)O)Br
InChIKey UVFWYVCDRKRAJH-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Bromo-5-nitrobenzoic acid (CAS: 943-14-6)?

2-Bromo-5-nitrobenzoic acid is a crystalline solid with a molecular weight of approximately 229.03 g...

Compound Q&A

What industries use 2-Bromo-5-nitrobenzoic acid (CAS: 943-14-6)?

2-Bromo-5-nitrobenzoic acid is used in the pharmaceutical industry for the synthesis of certain drug...

Compound Q&A

What precautions should be taken when handling 2-Bromo-5-nitrobenzoic acid (CAS: 943-14-6)?

When handling 2-Bromo-5-nitrobenzoic acid, it is essential to use appropriate personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...