Compound Q&A

What are the physical and chemical properties of 2-Bromo-5-nitrobenzoic acid (CAS: 943-14-6)?

Answer

2-Bromo-5-nitrobenzoic acid
2-Bromo-5-nitrobenzoic acid is a crystalline solid with a molecular weight of approximately 229.03 g/mol. It is slightly soluble in water but more soluble in organic solvents like ethanol and acetonitrile. The compound is moderately reactive, especially towards nucleophiles, and can undergo substitution reactions. It has a pKa of around 2.8 in aqueous solutions.

About

CAS No 943-14-6
English Name 2-Bromo-5-nitrobenzoic acid
Molecular Formula C7H4BrNO4
Molecular Weight 246.02 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])C(=O)O)Br
InChIKey UVFWYVCDRKRAJH-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

How is 2-Bromo-5-nitrobenzoic acid (CAS: 943-14-6) typically synthesized?

2-Bromo-5-nitrobenzoic acid is commonly synthesized by bromination of 5-nitrobenzoic acid using N-br...

Compound Q&A

What industries use 2-Bromo-5-nitrobenzoic acid (CAS: 943-14-6)?

2-Bromo-5-nitrobenzoic acid is used in the pharmaceutical industry for the synthesis of certain drug...

Compound Q&A

What precautions should be taken when handling 2-Bromo-5-nitrobenzoic acid (CAS: 943-14-6)?

When handling 2-Bromo-5-nitrobenzoic acid, it is essential to use appropriate personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...