Compound Q&A

What industries use (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butanoic acid (CAS: 125238-99-5)?

Answer

(2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butanoic acid
This compound is primarily used in the pharmaceutical industry for the synthesis of complex organic molecules and drug intermediates. It may also find applications in polymer chemistry, where its reactive functional groups can be utilized for polymerization reactions. In analytical chemistry, it can be used as a functional group in sensor development and as a building block in the fabrication of semiconductors.

About

English Name (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butanoic acid
Molecular Formula C24H28N2O6
Molecular Weight 440.5 g/mol
SMILES CC(C)(C)OC(=O)NCC[C@H](NC(=O)OCC1c2ccccc2-c3ccccc13)C(=O)O
InChIKey LIWKOFAHRLBNMG-FQEVSTJZSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

How is (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butanoic acid (CAS: 125238-99-5) typically synthesized?

The compound can be synthesized through multistep reactions involving coupling of fluorenylmethoxyca...

Compound Q&A

What precautions should be taken when handling (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butanoic acid (CAS: 125238-99-5)?

Proper personal protective equipment (PPE) should be worn when handling this compound, including glo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...