Compound Q&A

What are the physical and chemical properties of (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butanoic acid (CAS: 125238-99-5)?

Answer

(2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butanoic acid
This compound is a white to off-white crystalline solid. It has a molecular weight of approximately 519.46 g/mol. It is poorly soluble in water but has good solubility in organic solvents like DMSO and DMF. The compound is chemically stable under normal conditions but can be sensitive to strong acids or bases. It exhibits moderate reactivity towards nucleophiles and electrophiles.

About

English Name (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butanoic acid
Molecular Formula C24H28N2O6
Molecular Weight 440.5 g/mol
SMILES CC(C)(C)OC(=O)NCC[C@H](NC(=O)OCC1c2ccccc2-c3ccccc13)C(=O)O
InChIKey LIWKOFAHRLBNMG-FQEVSTJZSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

How is (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butanoic acid (CAS: 125238-99-5) typically synthesized?

The compound can be synthesized through multistep reactions involving coupling of fluorenylmethoxyca...

Compound Q&A

What industries use (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butanoic acid (CAS: 125238-99-5)?

This compound is primarily used in the pharmaceutical industry for the synthesis of complex organic ...

Compound Q&A

What precautions should be taken when handling (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butanoic acid (CAS: 125238-99-5)?

Proper personal protective equipment (PPE) should be worn when handling this compound, including glo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...