Compound Q&A

How is (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butanoic acid (CAS: 125238-99-5) typically synthesized?

Answer

(2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butanoic acid
The compound can be synthesized through multistep reactions involving coupling of fluorenylmethoxycarbonyl protected amino acids with 2-methyl-2-propanol via a carbonyl compound. Common methods include peptide coupling reactions using standard Fmoc chemistry and subsequent deprotection steps. Reaction conditions typically involve the use of appropriate bases and solvents to ensure high yields and selectivity.

About

English Name (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butanoic acid
Molecular Formula C24H28N2O6
Molecular Weight 440.5 g/mol
SMILES CC(C)(C)OC(=O)NCC[C@H](NC(=O)OCC1c2ccccc2-c3ccccc13)C(=O)O
InChIKey LIWKOFAHRLBNMG-FQEVSTJZSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What industries use (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butanoic acid (CAS: 125238-99-5)?

This compound is primarily used in the pharmaceutical industry for the synthesis of complex organic ...

Compound Q&A

What precautions should be taken when handling (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butanoic acid (CAS: 125238-99-5)?

Proper personal protective equipment (PPE) should be worn when handling this compound, including glo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...