Compound Q&A

What industries use Methyl 5-bromo-2-(bromomethyl)benzoate (CAS: 79670-17-0)?

Answer

Methyl 5-bromo-2-(bromomethyl)benzoate
Methyl 5-bromo-2-(bromomethyl)benzoate (CAS: 79670-17-0) is primarily used in the pharmaceutical and polymer industries due to its reactivity. It serves as a key intermediate in various organic synthesis routes and is also explored for its potential in developing advanced materials and sensors.

About

CAS No 79670-17-0
English Name Methyl 5-bromo-2-(bromomethyl)benzoate
Molecular Formula C9H8Br2O2
Molecular Weight 307.97 g/mol
SMILES COC(=O)C1=C(C=CC(=C1)Br)CBr
InChIKey UVIJBFVFEGZZLQ-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 5-bromo-2-(bromomethyl)benzoate (CAS: 79670-17-0)?

Methyl 5-bromo-2-(bromomethyl)benzoate (CAS: 79670-17-0) is a crystalline solid with a molecular wei...

Compound Q&A

How is Methyl 5-bromo-2-(bromomethyl)benzoate (CAS: 79670-17-0) typically synthesized?

Methyl 5-bromo-2-(bromomethyl)benzoate (CAS: 79670-17-0) is commonly synthesized via a two-step proc...

Compound Q&A

What precautions should be taken when handling Methyl 5-bromo-2-(bromomethyl)benzoate (CAS: 79670-17-0)?

When handling Methyl 5-bromo-2-(bromomethyl)benzoate (CAS: 79670-17-0), it is crucial to use appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...