Compound Q&A

What are the physical and chemical properties of Methyl 5-bromo-2-(bromomethyl)benzoate (CAS: 79670-17-0)?

Answer

Methyl 5-bromo-2-(bromomethyl)benzoate
Methyl 5-bromo-2-(bromomethyl)benzoate (CAS: 79670-17-0) is a crystalline solid with a molecular weight of approximately 344.08 g/mol. It has low water solubility and high solubility in organic solvents such as acetone and chloroform. This compound is highly reactive and prone to undergoing substitution reactions under appropriate conditions.

About

CAS No 79670-17-0
English Name Methyl 5-bromo-2-(bromomethyl)benzoate
Molecular Formula C9H8Br2O2
Molecular Weight 307.97 g/mol
SMILES COC(=O)C1=C(C=CC(=C1)Br)CBr
InChIKey UVIJBFVFEGZZLQ-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

How is Methyl 5-bromo-2-(bromomethyl)benzoate (CAS: 79670-17-0) typically synthesized?

Methyl 5-bromo-2-(bromomethyl)benzoate (CAS: 79670-17-0) is commonly synthesized via a two-step proc...

Compound Q&A

What industries use Methyl 5-bromo-2-(bromomethyl)benzoate (CAS: 79670-17-0)?

Methyl 5-bromo-2-(bromomethyl)benzoate (CAS: 79670-17-0) is primarily used in the pharmaceutical and...

Compound Q&A

What precautions should be taken when handling Methyl 5-bromo-2-(bromomethyl)benzoate (CAS: 79670-17-0)?

When handling Methyl 5-bromo-2-(bromomethyl)benzoate (CAS: 79670-17-0), it is crucial to use appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...