Compound Q&A

How is Methyl 5-bromo-2-(bromomethyl)benzoate (CAS: 79670-17-0) typically synthesized?

Answer

Methyl 5-bromo-2-(bromomethyl)benzoate
Methyl 5-bromo-2-(bromomethyl)benzoate (CAS: 79670-17-0) is commonly synthesized via a two-step process. First, 5-bromo-2-hydroxymethylbenzoic acid is brominated to form the key intermediate, followed by esterification with methyl alcohol. The reaction typically proceeds with high selectivity and moderate yield, depending on the reaction conditions.

About

CAS No 79670-17-0
English Name Methyl 5-bromo-2-(bromomethyl)benzoate
Molecular Formula C9H8Br2O2
Molecular Weight 307.97 g/mol
SMILES COC(=O)C1=C(C=CC(=C1)Br)CBr
InChIKey UVIJBFVFEGZZLQ-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 5-bromo-2-(bromomethyl)benzoate (CAS: 79670-17-0)?

Methyl 5-bromo-2-(bromomethyl)benzoate (CAS: 79670-17-0) is a crystalline solid with a molecular wei...

Compound Q&A

What industries use Methyl 5-bromo-2-(bromomethyl)benzoate (CAS: 79670-17-0)?

Methyl 5-bromo-2-(bromomethyl)benzoate (CAS: 79670-17-0) is primarily used in the pharmaceutical and...

Compound Q&A

What precautions should be taken when handling Methyl 5-bromo-2-(bromomethyl)benzoate (CAS: 79670-17-0)?

When handling Methyl 5-bromo-2-(bromomethyl)benzoate (CAS: 79670-17-0), it is crucial to use appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...