Compound Q&A

What precautions should be taken when handling Triisopropylsilyl methacrylate (CAS: 134652-60-1)?

Answer

Triisopropylsilyl methacrylate
When handling Triisopropylsilyl methacrylate (CAS: 134652-60-1), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to minimize inhalation risk. Spills should be carefully cleaned up using absorbent materials and proper disposal procedures should be followed. Always refer to the Safety Data Sheet (SDS) for specific handling guidelines.

About

English Name Triisopropylsilyl methacrylate
Molecular Formula C13H26O2Si
Molecular Weight 242.43 g/mol
SMILES CC(C)[Si](C(C)C)(C(C)C)OC(=O)C(=C)C
InChIKey KNNOZYMZRGTZQM-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of Triisopropylsilyl methacrylate (CAS: 134652-60-1)?

Triisopropylsilyl methacrylate (CAS: 134652-60-1) is a colorless liquid with a molecular weight of a...

Compound Q&A

How is Triisopropylsilyl methacrylate (CAS: 134652-60-1) typically synthesized?

Triisopropylsilyl methacrylate is typically synthesized by the reaction of methacryloyl chloride wit...

Compound Q&A

What industries use Triisopropylsilyl methacrylate (CAS: 134652-60-1)?

Triisopropylsilyl methacrylate (CAS: 134652-60-1) is used in the pharmaceutical, polymer, and semico...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...