Compound Q&A

What industries use Triisopropylsilyl methacrylate (CAS: 134652-60-1)?

Answer

Triisopropylsilyl methacrylate
Triisopropylsilyl methacrylate (CAS: 134652-60-1) is used in the pharmaceutical, polymer, and semiconductor industries. It is an important monomer for the synthesis of functionalized polymers and also finds applications in the production of sensors and as a precursor in the semiconductor manufacturing process.

About

English Name Triisopropylsilyl methacrylate
Molecular Formula C13H26O2Si
Molecular Weight 242.43 g/mol
SMILES CC(C)[Si](C(C)C)(C(C)C)OC(=O)C(=C)C
InChIKey KNNOZYMZRGTZQM-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of Triisopropylsilyl methacrylate (CAS: 134652-60-1)?

Triisopropylsilyl methacrylate (CAS: 134652-60-1) is a colorless liquid with a molecular weight of a...

Compound Q&A

How is Triisopropylsilyl methacrylate (CAS: 134652-60-1) typically synthesized?

Triisopropylsilyl methacrylate is typically synthesized by the reaction of methacryloyl chloride wit...

Compound Q&A

What precautions should be taken when handling Triisopropylsilyl methacrylate (CAS: 134652-60-1)?

When handling Triisopropylsilyl methacrylate (CAS: 134652-60-1), it is essential to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...