Compound Q&A

What are the physical and chemical properties of Triisopropylsilyl methacrylate (CAS: 134652-60-1)?

Answer

Triisopropylsilyl methacrylate
Triisopropylsilyl methacrylate (CAS: 134652-60-1) is a colorless liquid with a molecular weight of approximately 258.4 g/mol. It has a low boiling point and is poorly soluble in water but miscible with organic solvents. Chemically, it is reactive and undergoes polymerization easily under appropriate conditions.

About

English Name Triisopropylsilyl methacrylate
Molecular Formula C13H26O2Si
Molecular Weight 242.43 g/mol
SMILES CC(C)[Si](C(C)C)(C(C)C)OC(=O)C(=C)C
InChIKey KNNOZYMZRGTZQM-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

How is Triisopropylsilyl methacrylate (CAS: 134652-60-1) typically synthesized?

Triisopropylsilyl methacrylate is typically synthesized by the reaction of methacryloyl chloride wit...

Compound Q&A

What industries use Triisopropylsilyl methacrylate (CAS: 134652-60-1)?

Triisopropylsilyl methacrylate (CAS: 134652-60-1) is used in the pharmaceutical, polymer, and semico...

Compound Q&A

What precautions should be taken when handling Triisopropylsilyl methacrylate (CAS: 134652-60-1)?

When handling Triisopropylsilyl methacrylate (CAS: 134652-60-1), it is essential to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...