Compound Q&A

What precautions should be taken when handling 1,3,5-Tris(3-bromophenyl)benzene (CAS: 96761-85-2)?

Answer

1,3,5-Tris(3-bromophenyl)benzene
When handling 1,3,5-Tris(3-bromophenyl)benzene (CAS: 96761-85-2), it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. It should be stored in a cool, dry, and well-ventilated area, preferably in a fume hood. Spills should be cleaned up using appropriate absorbents and handled according to the Material Safety Data Sheet (SDS).

About

CAS No 96761-85-2
English Name 1,3,5-Tris(3-bromophenyl)benzene
Molecular Formula C24H15Br3
Molecular Weight 543.1 g/mol
SMILES C1=CC(=CC(=C1)Br)C2=CC(=CC(=C2)C3=CC(=CC=C3)Br)C4=CC(=CC=C4)Br
InChIKey JKCQADHKVQXKFF-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,3,5-Tris(3-bromophenyl)benzene (CAS: 96761-85-2)?

1,3,5-Tris(3-bromophenyl)benzene (CAS: 96761-85-2) is a crystalline compound with a high melting poi...

Compound Q&A

How is 1,3,5-Tris(3-bromophenyl)benzene (CAS: 96761-85-2) typically synthesized?

1,3,5-Tris(3-bromophenyl)benzene (CAS: 96761-85-2) is typically synthesized through a multistep proc...

Compound Q&A

What industries use 1,3,5-Tris(3-bromophenyl)benzene (CAS: 96761-85-2)?

1,3,5-Tris(3-bromophenyl)benzene (CAS: 96761-85-2) is used in various industries, including pharmace...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...