Compound Q&A

How is 1,3,5-Tris(3-bromophenyl)benzene (CAS: 96761-85-2) typically synthesized?

Answer

1,3,5-Tris(3-bromophenyl)benzene
1,3,5-Tris(3-bromophenyl)benzene (CAS: 96761-85-2) is typically synthesized through a multistep process involving bromination of benzene and subsequent coupling reactions. The synthesis often requires the use of Lewis acids as catalysts and is conducted under anhydrous conditions. The overall yield is moderate to good, depending on the synthetic method and conditions.

About

CAS No 96761-85-2
English Name 1,3,5-Tris(3-bromophenyl)benzene
Molecular Formula C24H15Br3
Molecular Weight 543.1 g/mol
SMILES C1=CC(=CC(=C1)Br)C2=CC(=CC(=C2)C3=CC(=CC=C3)Br)C4=CC(=CC=C4)Br
InChIKey JKCQADHKVQXKFF-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,3,5-Tris(3-bromophenyl)benzene (CAS: 96761-85-2)?

1,3,5-Tris(3-bromophenyl)benzene (CAS: 96761-85-2) is a crystalline compound with a high melting poi...

Compound Q&A

What industries use 1,3,5-Tris(3-bromophenyl)benzene (CAS: 96761-85-2)?

1,3,5-Tris(3-bromophenyl)benzene (CAS: 96761-85-2) is used in various industries, including pharmace...

Compound Q&A

What precautions should be taken when handling 1,3,5-Tris(3-bromophenyl)benzene (CAS: 96761-85-2)?

When handling 1,3,5-Tris(3-bromophenyl)benzene (CAS: 96761-85-2), it is essential to use appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...