Compound Q&A

What are the physical and chemical properties of 1,3,5-Tris(3-bromophenyl)benzene (CAS: 96761-85-2)?

Answer

1,3,5-Tris(3-bromophenyl)benzene
1,3,5-Tris(3-bromophenyl)benzene (CAS: 96761-85-2) is a crystalline compound with a high melting point. Its molecular weight is approximately 468.01 g/mol. This compound is poorly soluble in water but has good solubility in organic solvents like chloroform and ethanol. Chemically, it is relatively stable but can undergo substitution reactions under certain conditions, making it useful in organic synthesis and materials science.

About

CAS No 96761-85-2
English Name 1,3,5-Tris(3-bromophenyl)benzene
Molecular Formula C24H15Br3
Molecular Weight 543.1 g/mol
SMILES C1=CC(=CC(=C1)Br)C2=CC(=CC(=C2)C3=CC(=CC=C3)Br)C4=CC(=CC=C4)Br
InChIKey JKCQADHKVQXKFF-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

How is 1,3,5-Tris(3-bromophenyl)benzene (CAS: 96761-85-2) typically synthesized?

1,3,5-Tris(3-bromophenyl)benzene (CAS: 96761-85-2) is typically synthesized through a multistep proc...

Compound Q&A

What industries use 1,3,5-Tris(3-bromophenyl)benzene (CAS: 96761-85-2)?

1,3,5-Tris(3-bromophenyl)benzene (CAS: 96761-85-2) is used in various industries, including pharmace...

Compound Q&A

What precautions should be taken when handling 1,3,5-Tris(3-bromophenyl)benzene (CAS: 96761-85-2)?

When handling 1,3,5-Tris(3-bromophenyl)benzene (CAS: 96761-85-2), it is essential to use appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...