Compound Q&A

What precautions should be taken when handling 1-Benzothiophene-2-carboxylic acid (CAS: 6314-28-9)?

Answer

1-Benzothiophene-2-carboxylic acid
When handling 1-Benzothiophene-2-carboxylic acid, it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Ensure the work is conducted in a well-ventilated environment or a fume hood. Spills should be carefully cleaned up using absorbent materials, followed by thorough rinsing with water. Refer to the Safety Data Sheet (SDS) for detailed information on handling and disposal.

About

CAS No 6314-28-9
English Name 1-Benzothiophene-2-carboxylic acid
Molecular Formula C9H6O2S
Molecular Weight 178.21 g/mol
SMILES C1=CC=C2C(=C1)C=C(S2)C(=O)O
InChIKey DYSJMQABFPKAQM-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Benzothiophene-2-carboxylic acid (CAS: 6314-28-9)?

1-Benzothiophene-2-carboxylic acid is a crystalline solid with a molecular weight of approximately 1...

Compound Q&A

How is 1-Benzothiophene-2-carboxylic acid (CAS: 6314-28-9) typically synthesized?

1-Benzothiophene-2-carboxylic acid is typically synthesized via the hydrolysis of 1-benzothiophene-2...

Compound Q&A

What industries use 1-Benzothiophene-2-carboxylic acid (CAS: 6314-28-9)?

1-Benzothiophene-2-carboxylic acid is mainly used in the pharmaceutical industry for the synthesis o...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...