Compound Q&A

How is 1-Benzothiophene-2-carboxylic acid (CAS: 6314-28-9) typically synthesized?

Answer

1-Benzothiophene-2-carboxylic acid
1-Benzothiophene-2-carboxylic acid is typically synthesized via the hydrolysis of 1-benzothiophene-2-carboxylic anhydride using a strong acid catalyst like sulfuric acid. The yield is around 85-90%, and the reaction involves the addition of water to the anhydride, followed by neutralization of the acid to form the carboxylic acid.

About

CAS No 6314-28-9
English Name 1-Benzothiophene-2-carboxylic acid
Molecular Formula C9H6O2S
Molecular Weight 178.21 g/mol
SMILES C1=CC=C2C(=C1)C=C(S2)C(=O)O
InChIKey DYSJMQABFPKAQM-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Benzothiophene-2-carboxylic acid (CAS: 6314-28-9)?

1-Benzothiophene-2-carboxylic acid is a crystalline solid with a molecular weight of approximately 1...

Compound Q&A

What industries use 1-Benzothiophene-2-carboxylic acid (CAS: 6314-28-9)?

1-Benzothiophene-2-carboxylic acid is mainly used in the pharmaceutical industry for the synthesis o...

Compound Q&A

What precautions should be taken when handling 1-Benzothiophene-2-carboxylic acid (CAS: 6314-28-9)?

When handling 1-Benzothiophene-2-carboxylic acid, it is essential to wear appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...