Compound Q&A

What are the physical and chemical properties of 1-Benzothiophene-2-carboxylic acid (CAS: 6314-28-9)?

Answer

1-Benzothiophene-2-carboxylic acid
1-Benzothiophene-2-carboxylic acid is a crystalline solid with a molecular weight of approximately 180.23 g/mol. It has a melting point of about 148-150°C and is slightly soluble in water. Chemically, it is moderately reactive, capable of undergoing esterification and condensation reactions. It shows good solubility in organic solvents like acetone and ethanol.

About

CAS No 6314-28-9
English Name 1-Benzothiophene-2-carboxylic acid
Molecular Formula C9H6O2S
Molecular Weight 178.21 g/mol
SMILES C1=CC=C2C(=C1)C=C(S2)C(=O)O
InChIKey DYSJMQABFPKAQM-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

How is 1-Benzothiophene-2-carboxylic acid (CAS: 6314-28-9) typically synthesized?

1-Benzothiophene-2-carboxylic acid is typically synthesized via the hydrolysis of 1-benzothiophene-2...

Compound Q&A

What industries use 1-Benzothiophene-2-carboxylic acid (CAS: 6314-28-9)?

1-Benzothiophene-2-carboxylic acid is mainly used in the pharmaceutical industry for the synthesis o...

Compound Q&A

What precautions should be taken when handling 1-Benzothiophene-2-carboxylic acid (CAS: 6314-28-9)?

When handling 1-Benzothiophene-2-carboxylic acid, it is essential to wear appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...