Compound Q&A

What industries use Nortriptyline EP Impurity E HCl (CAS: 6202-23-9)?

Answer

Nortriptyline EP Impurity E HCl (Amitriptyline EP Impurity B HCl)
Nortriptyline EP Impurity E HCl is primarily used in the pharmaceutical industry for the synthesis and quality control of antidepressants. While it has limited direct applications, it plays a crucial role in the development and manufacturing of pharmaceutical products. Additionally, it may find use in analytical chemistry for impurity profiling and quality assurance purposes.

About

CAS No 6202-23-9
English Name Nortriptyline EP Impurity E HCl (Amitriptyline EP Impurity B HCl)
Molecular Formula C20H22ClN
Molecular Weight 311.86 g/mol
SMILES CN(C)CCC=C1C2=CC=CC=C2C=CC3=CC=CC=C31.Cl
InChIKey VXEAYBOGHINOKW-UHFFFAOYSA-N
Last Updated: 2025-09-26 00:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of Nortriptyline EP Impurity E HCl (CAS: 6202-23-9)?

Nortriptyline EP Impurity E HCl is a crystalline solid with a molecular weight of approximately 342....

Compound Q&A

How is Nortriptyline EP Impurity E HCl (CAS: 6202-23-9) typically synthesized?

Nortriptyline EP Impurity E HCl is synthesized through a series of steps involving the reduction of ...

Compound Q&A

What precautions should be taken when handling Nortriptyline EP Impurity E HCl (CAS: 6202-23-9)?

When handling Nortriptyline EP Impurity E HCl, it is essential to wear appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...