Compound Q&A

What industries use 4-Amino-5-chloro-2,3-dihydro-1-benzofuran-7-carboxylic acid (CAS: 123654-26-2)?

Answer

4-Amino-5-chloro-2,3-dihydro-1-benzofuran-7-carboxylic acid
4-Amino-5-chloro-2,3-dihydro-1-benzofuran-7-carboxylic acid is used in several industries. It is primarily applied in the pharmaceutical industry for the synthesis of biologically active compounds. It also finds use in the polymer industry as a crosslinking agent and in the development of sensors and semiconductors where its chemical properties are utilized.

About

English Name 4-Amino-5-chloro-2,3-dihydro-1-benzofuran-7-carboxylic acid
Molecular Formula C9H8ClNO3
Molecular Weight 213.62 g/mol
SMILES C1COC2=C1C(=C(C=C2C(=O)O)Cl)N
InChIKey KRMUVKSAOVLXLF-UHFFFAOYSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Amino-5-chloro-2,3-dihydro-1-benzofuran-7-carboxylic acid (CAS: 123654-26-2)?

4-Amino-5-chloro-2,3-dihydro-1-benzofuran-7-carboxylic acid is a white crystalline solid with a mole...

Compound Q&A

How is 4-Amino-5-chloro-2,3-dihydro-1-benzofuran-7-carboxylic acid (CAS: 123654-26-2) typically synthesized?

4-Amino-5-chloro-2,3-dihydro-1-benzofuran-7-carboxylic acid is typically synthesized via a multi-ste...

Compound Q&A

What precautions should be taken when handling 4-Amino-5-chloro-2,3-dihydro-1-benzofuran-7-carboxylic acid (CAS: 123654-26-2)?

When handling 4-Amino-5-chloro-2,3-dihydro-1-benzofuran-7-carboxylic acid, it is important to wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...