Compound Q&A

What are the physical and chemical properties of Benzyl [(3S)-2-oxotetrahydro-3-furanyl]carbamate (CAS: 35677-89-5)?

Answer

Benzyl [(3S)-2-oxotetrahydro-3-furanyl]carbamate
Benzyl [(3S)-2-oxotetrahydro-3-furanyl]carbamate is a white crystalline solid with a molecular weight of approximately 240.26 g/mol. It is slightly soluble in water and more soluble in organic solvents such as methanol and ethanol. The compound is known for its moderate reactivity, particularly in amide bond formation and nucleophilic substitution reactions.

About

CAS No 35677-89-5
English Name Benzyl [(3S)-2-oxotetrahydro-3-furanyl]carbamate
Molecular Formula C12H13NO4
Molecular Weight 235.24 g/mol
SMILES C1COC(=O)C1NC(=O)OCC2=CC=CC=C2
InChIKey FKWDZIFOVOUDAG-JTQLQIEISA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

How is Benzyl [(3S)-2-oxotetrahydro-3-furanyl]carbamate (CAS: 35677-89-5) typically synthesized?

Benzyl [(3S)-2-oxotetrahydro-3-furanyl]carbamate can be synthesized via the reaction of benzyl chlor...

Compound Q&A

What industries use Benzyl [(3S)-2-oxotetrahydro-3-furanyl]carbamate (CAS: 35677-89-5)?

Benzyl [(3S)-2-oxotetrahydro-3-furanyl]carbamate is mainly used in the pharmaceutical industry for t...

Compound Q&A

What precautions should be taken when handling Benzyl [(3S)-2-oxotetrahydro-3-furanyl]carbamate (CAS: 35677-89-5)?

Proper handling of Benzyl [(3S)-2-oxotetrahydro-3-furanyl]carbamate includes the use of personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...