Compound Q&A

What are the physical and chemical properties of 2-[(4-Amino-3-methylphenyl)(ethyl)amino]ethanol sulfate (1:1) (CAS: 25646-77-9)?

Answer

2-[(4-Amino-3-methylphenyl)(ethyl)amino]ethanol sulfate (1:1)
2-[(4-Amino-3-methylphenyl)(ethyl)amino]ethanol sulfate (1:1) is a crystalline solid with a molecular weight of approximately 357.43 g/mol. It has a pKa around 10.3, indicating basicity. The compound is moderately soluble in water but less so in organic solvents. It exhibits good reactivity towards proton donors and nucleophiles due to the presence of the amine and hydroxyl groups.

About

CAS No 25646-77-9
English Name 2-[(4-Amino-3-methylphenyl)(ethyl)amino]ethanol sulfate (1:1)
Molecular Formula C11H20N2O5S
Molecular Weight 292.36 g/mol
SMILES CCN(CCO)C1=CC(=C(C=C1)N)C.OS(=O)(=O)O
InChIKey GVEYRUKUJCHJSR-UHFFFAOYSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

How is 2-[(4-Amino-3-methylphenyl)(ethyl)amino]ethanol sulfate (1:1) (CAS: 25646-77-9) typically synthesized?

2-[(4-Amino-3-methylphenyl)(ethyl)amino]ethanol sulfate (1:1) can be synthesized by reacting 2-amino...

Compound Q&A

What industries use 2-[(4-Amino-3-methylphenyl)(ethyl)amino]ethanol sulfate (1:1) (CAS: 25646-77-9)?

2-[(4-Amino-3-methylphenyl)(ethyl)amino]ethanol sulfate (1:1) finds applications in pharmaceuticals ...

Compound Q&A

What precautions should be taken when handling 2-[(4-Amino-3-methylphenyl)(ethyl)amino]ethanol sulfate (1:1) (CAS: 25646-77-9)?

When handling 2-[(4-Amino-3-methylphenyl)(ethyl)amino]ethanol sulfate (1:1), ensure the use of appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...