Compound Q&A

What precautions should be taken when handling 2,4-Difluorobenzenesulfonyl chloride (CAS: 13918-92-8)?

Answer

2,4-Difluorobenzenesulfonyl chloride
2,4-Difluorobenzenesulfonyl chloride is corrosive and requires the use of personal protective equipment (PPE) such as gloves, goggles, and a lab coat. It should be handled in a well-ventilated area or under a fume hood to prevent inhalation. Spills should be cleaned up immediately using appropriate absorbents, and the area should be flushed with water. Always refer to the Safety Data Sheet (SDS) for detailed handling and emergency procedures.

About

CAS No 13918-92-8
English Name 2,4-Difluorobenzenesulfonyl chloride
Molecular Formula C6H3ClF2O2S
Molecular Weight 212.6 g/mol
SMILES C1=CC(=C(C=C1F)F)S(=O)(=O)Cl
InChIKey FJSAJUXIHJIAMD-UHFFFAOYSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4-Difluorobenzenesulfonyl chloride (CAS: 13918-92-8)?

2,4-Difluorobenzenesulfonyl chloride is a white crystalline solid with a molecular weight of approxi...

Compound Q&A

How is 2,4-Difluorobenzenesulfonyl chloride (CAS: 13918-92-8) typically synthesized?

2,4-Difluorobenzenesulfonyl chloride can be synthesized via the chlorosulfonylation of 2,4-difluorob...

Compound Q&A

What industries use 2,4-Difluorobenzenesulfonyl chloride (CAS: 13918-92-8)?

2,4-Difluorobenzenesulfonyl chloride is primarily used in the pharmaceutical industry, where it serv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...