Compound Q&A

How is 2,4-Difluorobenzenesulfonyl chloride (CAS: 13918-92-8) typically synthesized?

Answer

2,4-Difluorobenzenesulfonyl chloride
2,4-Difluorobenzenesulfonyl chloride can be synthesized via the chlorosulfonylation of 2,4-difluorobenzenesulfonic acid. This process is catalyzed by thionyl chloride in the presence of a solvent like toluene. The reaction is carried out under reflux conditions, yielding a high yield of the target compound.

About

CAS No 13918-92-8
English Name 2,4-Difluorobenzenesulfonyl chloride
Molecular Formula C6H3ClF2O2S
Molecular Weight 212.6 g/mol
SMILES C1=CC(=C(C=C1F)F)S(=O)(=O)Cl
InChIKey FJSAJUXIHJIAMD-UHFFFAOYSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4-Difluorobenzenesulfonyl chloride (CAS: 13918-92-8)?

2,4-Difluorobenzenesulfonyl chloride is a white crystalline solid with a molecular weight of approxi...

Compound Q&A

What industries use 2,4-Difluorobenzenesulfonyl chloride (CAS: 13918-92-8)?

2,4-Difluorobenzenesulfonyl chloride is primarily used in the pharmaceutical industry, where it serv...

Compound Q&A

What precautions should be taken when handling 2,4-Difluorobenzenesulfonyl chloride (CAS: 13918-92-8)?

2,4-Difluorobenzenesulfonyl chloride is corrosive and requires the use of personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...