Compound Q&A

How is Ganciclovir Mono-O-acetate (CAS: 88110-89-8) typically synthesized?

Answer

Ganciclovir Mono-O-acetate
Ganciclovir Mono-O-acetate (CAS: 88110-89-8) is typically synthesized by acetylation of ganciclovir. The reaction involves treating ganciclovir with acetic anhydride in the presence of a catalytic amount of an acid, such as sulfuric acid or p-toluenesulfonic acid, resulting in a high yield of the mono-O-acetate derivative.

About

CAS No 88110-89-8
English Name Ganciclovir Mono-O-acetate
Molecular Formula C11H15N5O5
Molecular Weight 297.27 g/mol
SMILES CC(=O)OCC(CO)OCN1C=NC2=C1N=C(NC2=O)N
InChIKey YKLKCCHLLFMWQE-UHFFFAOYSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ganciclovir Mono-O-acetate (CAS: 88110-89-8)?

Ganciclovir Mono-O-acetate (CAS: 88110-89-8) is a white or off-white crystalline powder with a molec...

Compound Q&A

What industries use Ganciclovir Mono-O-acetate (CAS: 88110-89-8)?

Ganciclovir Mono-O-acetate (CAS: 88110-89-8) is primarily used in the pharmaceutical industry for th...

Compound Q&A

What precautions should be taken when handling Ganciclovir Mono-O-acetate (CAS: 88110-89-8)?

When handling Ganciclovir Mono-O-acetate (CAS: 88110-89-8), it is essential to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...