Compound Q&A

What are the physical and chemical properties of Ganciclovir Mono-O-acetate (CAS: 88110-89-8)?

Answer

Ganciclovir Mono-O-acetate
Ganciclovir Mono-O-acetate (CAS: 88110-89-8) is a white or off-white crystalline powder with a molecular weight of approximately 367.4 g/mol. It is moderately soluble in water and ethanol. Chemically, it is stable under normal conditions but can be hydrolyzed in strong acidic or basic conditions. It reacts readily with nucleophiles, making it useful for further chemical modifications.

About

CAS No 88110-89-8
English Name Ganciclovir Mono-O-acetate
Molecular Formula C11H15N5O5
Molecular Weight 297.27 g/mol
SMILES CC(=O)OCC(CO)OCN1C=NC2=C1N=C(NC2=O)N
InChIKey YKLKCCHLLFMWQE-UHFFFAOYSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

How is Ganciclovir Mono-O-acetate (CAS: 88110-89-8) typically synthesized?

Ganciclovir Mono-O-acetate (CAS: 88110-89-8) is typically synthesized by acetylation of ganciclovir....

Compound Q&A

What industries use Ganciclovir Mono-O-acetate (CAS: 88110-89-8)?

Ganciclovir Mono-O-acetate (CAS: 88110-89-8) is primarily used in the pharmaceutical industry for th...

Compound Q&A

What precautions should be taken when handling Ganciclovir Mono-O-acetate (CAS: 88110-89-8)?

When handling Ganciclovir Mono-O-acetate (CAS: 88110-89-8), it is essential to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...