Compound Q&A

What precautions should be taken when handling 3,4-Diamino Benzophenone (CAS: 39070-63-8)?

Answer

3,4-Diamino Benzophenone
When handling 3,4-Diamino Benzophenone (CAS: 39070-63-8), it is essential to wear personal protective equipment (PPE) such as gloves, goggles, and a lab coat. It should be stored in a closed container away from direct sunlight and heat sources. Fume hoods should be used during handling to minimize exposure to fumes. In case of a spill, it should be cleaned up using absorbent materials, and the area should be ventilated. Always refer to the Safety Data Sheet (SDS) for detailed safety information.

About

CAS No 39070-63-8
English Name 3,4-Diamino Benzophenone
Molecular Formula C13H12N2O
Molecular Weight 212.25 g/mol
SMILES C1=CC=C(C=C1)C(=O)C2=CC(=C(C=C2)N)N
InChIKey RXCOGDYOZQGGMK-UHFFFAOYSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,4-Diamino Benzophenone (CAS: 39070-63-8)?

3,4-Diamino Benzophenone (CAS: 39070-63-8) is a white crystalline solid with a molecular weight of 1...

Compound Q&A

How is 3,4-Diamino Benzophenone (CAS: 39070-63-8) typically synthesized?

3,4-Diamino Benzophenone (CAS: 39070-63-8) is typically synthesized via the reaction of 2,3-diaminob...

Compound Q&A

What industries use 3,4-Diamino Benzophenone (CAS: 39070-63-8)?

3,4-Diamino Benzophenone (CAS: 39070-63-8) is used in various industries. It is primarily employed i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...