Compound Q&A

What are the physical and chemical properties of 3,4-Diamino Benzophenone (CAS: 39070-63-8)?

Answer

3,4-Diamino Benzophenone
3,4-Diamino Benzophenone (CAS: 39070-63-8) is a white crystalline solid with a molecular weight of 196.18 g/mol. It has a high solubility in organic solvents like DMF and DMSO but is poorly soluble in water. Chemically, it is highly reactive, particularly towards nucleophiles and electrophiles, making it useful in various synthetic applications. It has an ortho-diamino group and a benzophenone core, which contributes to its unique reactivity and stability.

About

CAS No 39070-63-8
English Name 3,4-Diamino Benzophenone
Molecular Formula C13H12N2O
Molecular Weight 212.25 g/mol
SMILES C1=CC=C(C=C1)C(=O)C2=CC(=C(C=C2)N)N
InChIKey RXCOGDYOZQGGMK-UHFFFAOYSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

How is 3,4-Diamino Benzophenone (CAS: 39070-63-8) typically synthesized?

3,4-Diamino Benzophenone (CAS: 39070-63-8) is typically synthesized via the reaction of 2,3-diaminob...

Compound Q&A

What industries use 3,4-Diamino Benzophenone (CAS: 39070-63-8)?

3,4-Diamino Benzophenone (CAS: 39070-63-8) is used in various industries. It is primarily employed i...

Compound Q&A

What precautions should be taken when handling 3,4-Diamino Benzophenone (CAS: 39070-63-8)?

When handling 3,4-Diamino Benzophenone (CAS: 39070-63-8), it is essential to wear personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...