Compound Q&A

What precautions should be taken when handling 1-Ethyl-3-methylimidazolium Diethyl Phosphate (CAS: 848641-69-0)?

Answer

1-Ethyl-3-methylimidazolium Diethyl Phosphate
When handling 1-Ethyl-3-methylimidazolium Diethyl Phosphate (CAS: 848641-69-0), ensure the use of personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work in a fume hood due to its reactivity. Spills should be cleaned up using an appropriate absorbent material and disposing of it according to local regulations. Always refer to the Safety Data Sheet (SDS) for detailed handling and safety information.

About

English Name 1-Ethyl-3-methylimidazolium Diethyl Phosphate
Molecular Formula C10H21N2O4P
Molecular Weight 264.26 g/mol
SMILES CC[N+]1=CN(C)C=C1.CCOP([O-])(=O)OCC
InChIKey HQWOEDCLDNFWEV-UHFFFAOYSA-M
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Ethyl-3-methylimidazolium Diethyl Phosphate (CAS: 848641-69-0)?

1-Ethyl-3-methylimidazolium Diethyl Phosphate (CAS: 848641-69-0) is a solid with a crystalline form....

Compound Q&A

How is 1-Ethyl-3-methylimidazolium Diethyl Phosphate (CAS: 848641-69-0) typically synthesized?

1-Ethyl-3-methylimidazolium Diethyl Phosphate (CAS: 848641-69-0) is synthesized by reacting 1-ethyl-...

Compound Q&A

What industries use 1-Ethyl-3-methylimidazolium Diethyl Phosphate (CAS: 848641-69-0)?

1-Ethyl-3-methylimidazolium Diethyl Phosphate (CAS: 848641-69-0) is used in various industries inclu...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...