Compound Q&A

What industries use 1-Ethyl-3-methylimidazolium Diethyl Phosphate (CAS: 848641-69-0)?

Answer

1-Ethyl-3-methylimidazolium Diethyl Phosphate
1-Ethyl-3-methylimidazolium Diethyl Phosphate (CAS: 848641-69-0) is used in various industries including pharmaceuticals, polymers, and sensors. It is particularly valuable in electrochemistry and catalysis due to its unique reactivity and stability in aqueous media.

About

English Name 1-Ethyl-3-methylimidazolium Diethyl Phosphate
Molecular Formula C10H21N2O4P
Molecular Weight 264.26 g/mol
SMILES CC[N+]1=CN(C)C=C1.CCOP([O-])(=O)OCC
InChIKey HQWOEDCLDNFWEV-UHFFFAOYSA-M
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Ethyl-3-methylimidazolium Diethyl Phosphate (CAS: 848641-69-0)?

1-Ethyl-3-methylimidazolium Diethyl Phosphate (CAS: 848641-69-0) is a solid with a crystalline form....

Compound Q&A

How is 1-Ethyl-3-methylimidazolium Diethyl Phosphate (CAS: 848641-69-0) typically synthesized?

1-Ethyl-3-methylimidazolium Diethyl Phosphate (CAS: 848641-69-0) is synthesized by reacting 1-ethyl-...

Compound Q&A

What precautions should be taken when handling 1-Ethyl-3-methylimidazolium Diethyl Phosphate (CAS: 848641-69-0)?

When handling 1-Ethyl-3-methylimidazolium Diethyl Phosphate (CAS: 848641-69-0), ensure the use of pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...