Compound Q&A

What are the physical and chemical properties of 1-Ethyl-3-methylimidazolium Diethyl Phosphate (CAS: 848641-69-0)?

Answer

1-Ethyl-3-methylimidazolium Diethyl Phosphate
1-Ethyl-3-methylimidazolium Diethyl Phosphate (CAS: 848641-69-0) is a solid with a crystalline form. Its molecular weight is approximately 300.38 g/mol. It is moderately soluble in water and organic solvents. Chemically, it is highly reactive, particularly with nucleophiles. It can readily undergo nucleophilic substitution reactions and is used in various applications due to its unique reactivity.

About

English Name 1-Ethyl-3-methylimidazolium Diethyl Phosphate
Molecular Formula C10H21N2O4P
Molecular Weight 264.26 g/mol
SMILES CC[N+]1=CN(C)C=C1.CCOP([O-])(=O)OCC
InChIKey HQWOEDCLDNFWEV-UHFFFAOYSA-M
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

How is 1-Ethyl-3-methylimidazolium Diethyl Phosphate (CAS: 848641-69-0) typically synthesized?

1-Ethyl-3-methylimidazolium Diethyl Phosphate (CAS: 848641-69-0) is synthesized by reacting 1-ethyl-...

Compound Q&A

What industries use 1-Ethyl-3-methylimidazolium Diethyl Phosphate (CAS: 848641-69-0)?

1-Ethyl-3-methylimidazolium Diethyl Phosphate (CAS: 848641-69-0) is used in various industries inclu...

Compound Q&A

What precautions should be taken when handling 1-Ethyl-3-methylimidazolium Diethyl Phosphate (CAS: 848641-69-0)?

When handling 1-Ethyl-3-methylimidazolium Diethyl Phosphate (CAS: 848641-69-0), ensure the use of pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...