Compound Q&A

What precautions should be taken when handling 6-Amino-4-{[3-chloro-4-(2-pyridinylmethoxy)phenyl]amino}-7-ethoxy-3-quinolinecarbonitrile (CAS: 848139-78-6)?

Answer

6-Amino-4-{[3-chloro-4-(2-pyridinylmethoxy)phenyl]amino}-7-ethoxy-3-quinolinecarbonitrile
Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn. The compound should be handled in a well-ventilated area or fume hood. Spills should be cleaned up immediately using appropriate absorbents, and the material safety data sheet (MSDS) should be consulted for detailed procedures.

About

English Name 6-Amino-4-{[3-chloro-4-(2-pyridinylmethoxy)phenyl]amino}-7-ethoxy-3-quinolinecarbonitrile
Molecular Formula C24H20ClN5O2
Molecular Weight 17.03 g/mol
SMILES N#CC1=C(NC2=CC=C(OCC3=NC=CC=C3)C(Cl)=C2)C4=CC(N)=C(OCC)C=C4N=C1
InChIKey WRGKROVGVSWJMI-UHFFFAOYSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Amino-4-{[3-chloro-4-(2-pyridinylmethoxy)phenyl]amino}-7-ethoxy-3-quinolinecarbonitrile (CAS: 848139-78-6)?

The compound has a crystalline form with a molecular weight of approximately 504.26 g/mol. It has li...

Compound Q&A

How is 6-Amino-4-{[3-chloro-4-(2-pyridinylmethoxy)phenyl]amino}-7-ethoxy-3-quinolinecarbonitrile (CAS: 848139-78-6) typically synthesized?

It is synthesized through a multi-step process involving the reaction of a pyridine derivative with ...

Compound Q&A

What industries use 6-Amino-4-{[3-chloro-4-(2-pyridinylmethoxy)phenyl]amino}-7-ethoxy-3-quinolinecarbonitrile (CAS: 848139-78-6)?

This compound is primarily used in the pharmaceutical industry for its potential as a bioactive comp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...