Compound Q&A

What are the physical and chemical properties of 6-Amino-4-{[3-chloro-4-(2-pyridinylmethoxy)phenyl]amino}-7-ethoxy-3-quinolinecarbonitrile (CAS: 848139-78-6)?

Answer

6-Amino-4-{[3-chloro-4-(2-pyridinylmethoxy)phenyl]amino}-7-ethoxy-3-quinolinecarbonitrile
The compound has a crystalline form with a molecular weight of approximately 504.26 g/mol. It has limited water solubility, being slightly soluble in water. Chemically, it is reactive, particularly towards nucleophiles and can undergo substitution and elimination reactions. It is stable under normal conditions but should be protected from moisture and heat.

About

English Name 6-Amino-4-{[3-chloro-4-(2-pyridinylmethoxy)phenyl]amino}-7-ethoxy-3-quinolinecarbonitrile
Molecular Formula C24H20ClN5O2
Molecular Weight 17.03 g/mol
SMILES N#CC1=C(NC2=CC=C(OCC3=NC=CC=C3)C(Cl)=C2)C4=CC(N)=C(OCC)C=C4N=C1
InChIKey WRGKROVGVSWJMI-UHFFFAOYSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

How is 6-Amino-4-{[3-chloro-4-(2-pyridinylmethoxy)phenyl]amino}-7-ethoxy-3-quinolinecarbonitrile (CAS: 848139-78-6) typically synthesized?

It is synthesized through a multi-step process involving the reaction of a pyridine derivative with ...

Compound Q&A

What industries use 6-Amino-4-{[3-chloro-4-(2-pyridinylmethoxy)phenyl]amino}-7-ethoxy-3-quinolinecarbonitrile (CAS: 848139-78-6)?

This compound is primarily used in the pharmaceutical industry for its potential as a bioactive comp...

Compound Q&A

What precautions should be taken when handling 6-Amino-4-{[3-chloro-4-(2-pyridinylmethoxy)phenyl]amino}-7-ethoxy-3-quinolinecarbonitrile (CAS: 848139-78-6)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn. T...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...