Compound Q&A

What industries use (4-(tert-Butoxycarbonyl)phenyl)boronic acid (CAS: 850568-54-6)?

Answer

(4-(tert-Butoxycarbonyl)phenyl)boronic acid
(4-(tert-Butoxycarbonyl)phenyl)boronic acid is primarily used in the pharmaceutical and polymer industries. It plays a crucial role in the synthesis of various drugs and polymers due to its reactivity in coupling reactions. Additionally, it is used in the development of sensors and semiconductors for its unique chemical properties.

About

English Name (4-(tert-Butoxycarbonyl)phenyl)boronic acid
Molecular Formula C11H15BO4
Molecular Weight 222.049 g/mol
SMILES B(C1=CC=C(C=C1)C(=O)OC(C)(C)C)(O)O
InChIKey QMVMDYSTJSUDKC-UHFFFAOYSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of (4-(tert-Butoxycarbonyl)phenyl)boronic acid (CAS: 850568-54-6)?

(4-(tert-Butoxycarbonyl)phenyl)boronic acid is a white to off-white crystalline solid with a molecul...

Compound Q&A

How is (4-(tert-Butoxycarbonyl)phenyl)boronic acid (CAS: 850568-54-6) typically synthesized?

(4-(tert-Butoxycarbonyl)phenyl)boronic acid is usually synthesized from tert-butoxycarbonyl phenyl b...

Compound Q&A

What precautions should be taken when handling (4-(tert-Butoxycarbonyl)phenyl)boronic acid (CAS: 850568-54-6)?

When handling (4-(tert-Butoxycarbonyl)phenyl)boronic acid, it is important to wear appropriate perso...

Compound Q&A

What precautions should be taken when handling 4-(2-Furylmethyl)thiomorpholine 1,1-dioxide (CAS: 79206-94-3)?

When handling 4-(2-Furylmethyl)thiomorpholine 1,1-dioxide (CAS: 79206-94-3), it ...

79206-94-34-(2-Furylmethyl)thi...
Compound Q&A

What precautions should be taken when handling 4-Chloro-N-[2-(4-morpholinyl)ethyl]benzamide (CAS: 71320-77-9)?

When handling 4-Chloro-N-[2-(4-morpholinyl)ethyl]benzamide (CAS: 71320-77-9), it...

71320-77-94-Chloro-N-[2-(4-mor...
Compound Q&A

How should waste containing 2-[2-(2-Methoxyethoxy)ethoxy]ethyl 4-methylbenzenesulfonate (CAS: 62921-74-8) be handled?

Waste containing this compound (CAS: 62921-74-8) should be handled according to ...

62921-74-82-[2-(2-Methoxyethox...
Compound Q&A

How should waste containing (S)-Methyl 2-amino-3-cyclohexylpropanoate be handled?

Waste containing (S)-Methyl 2-amino-3-cyclohexylpropanoate should be collected i...

40056-18-6(S)-Methyl 2-amino-3...