Compound Q&A

How is (4-(tert-Butoxycarbonyl)phenyl)boronic acid (CAS: 850568-54-6) typically synthesized?

Answer

(4-(tert-Butoxycarbonyl)phenyl)boronic acid
(4-(tert-Butoxycarbonyl)phenyl)boronic acid is usually synthesized from tert-butoxycarbonyl phenyl boronic acid via a boronic acid protection step using tert-butoxycarbonyl chloride. The reaction is typically performed at room temperature in the presence of a base like triethylamine in a solvent such as dichloromethane or tetrahydrofuran. The purity and yield can be optimized by adjusting the reaction conditions and using appropriate purification techniques.

About

English Name (4-(tert-Butoxycarbonyl)phenyl)boronic acid
Molecular Formula C11H15BO4
Molecular Weight 222.05 g/mol
SMILES B(C1=CC=C(C=C1)C(=O)OC(C)(C)C)(O)O
InChIKey QMVMDYSTJSUDKC-UHFFFAOYSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of (4-(tert-Butoxycarbonyl)phenyl)boronic acid (CAS: 850568-54-6)?

(4-(tert-Butoxycarbonyl)phenyl)boronic acid is a white to off-white crystalline solid with a molecul...

Compound Q&A

What industries use (4-(tert-Butoxycarbonyl)phenyl)boronic acid (CAS: 850568-54-6)?

(4-(tert-Butoxycarbonyl)phenyl)boronic acid is primarily used in the pharmaceutical and polymer indu...

Compound Q&A

What precautions should be taken when handling (4-(tert-Butoxycarbonyl)phenyl)boronic acid (CAS: 850568-54-6)?

When handling (4-(tert-Butoxycarbonyl)phenyl)boronic acid, it is important to wear appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...